C17H25N3O4S — CID 9094330
methyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamothioylamino]butanoate (PubChem CID 9094330) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is methyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamothioylamino]butanoate.
| Compound Name | methyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 9094330 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | methyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamothioylamino]butanoate |
| SMILES | COC(=O)CCCNC(=S)NNC(=O)[C@@H](C)Oc1cccc(C)c1C |
| InChI | InChI=1S/C17H25N3O4S/c1-11-7-5-8-14(12(11)2)24-13(3)16(22)19-20-17(25)18-10-6-9-15(21)23-4/h5,7-8,13H,6,9-10H2,1-4H3,(H,19,22)(H2,18,20,25)/t13-/m1/s1 |
| InChIKey | AWRVNKXYPKOYRY-CYBMUJFWSA-N |
| XLogP | 1.52 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|