C18H22N2O3S — CID 24547272
2-(2,3-dimethylphenoxy)-N'-(3-thiophen-2-ylpropanoyl)propanehydrazide (PubChem CID 24547272) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N'-(3-thiophen-2-ylpropanoyl)propanehydrazide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N'-(3-thiophen-2-ylpropanoyl)propanehydrazide |
|---|---|
| PubChem CID | 24547272 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N'-(3-thiophen-2-ylpropanoyl)propanehydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)CCc2cccs2)c1C |
| InChI | InChI=1S/C18H22N2O3S/c1-12-6-4-8-16(13(12)2)23-14(3)18(22)20-19-17(21)10-9-15-7-5-11-24-15/h4-8,11,14H,9-10H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | XVVBJXQMGLATCT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|