C23H27N3O3S — CID 55380671
N'-[2-(2,3-dimethylphenoxy)propanoyl]-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carbohydrazide (PubChem CID 55380671) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylphenoxy)propanoyl]-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carbohydrazide.
| Compound Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 55380671 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carbohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2cc(C)n(Cc3cccs3)c2C)c1C |
| InChI | InChI=1S/C23H27N3O3S/c1-14-8-6-10-21(16(14)3)29-18(5)22(27)24-25-23(28)20-12-15(2)26(17(20)4)13-19-9-7-11-30-19/h6-12,18H,13H2,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | GESRZMHYTHFBQX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|