C18H19Cl2N3O2S — CID 8770339
1-[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]-3-(4-chlorophenyl)thiourea (PubChem CID 8770339) has the molecular formula C18H19Cl2N3O2S and a molecular weight of 412.34 g/mol. Its IUPAC name is 1-[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 8770339 |
| Molecular Formula | C18H19Cl2N3O2S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]-3-(4-chlorophenyl)thiourea |
| SMILES | Cc1cc(Cl)cc(C)c1O[C@H](C)C(=O)NNC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O2S/c1-10-8-14(20)9-11(2)16(10)25-12(3)17(24)22-23-18(26)21-15-6-4-13(19)5-7-15/h4-9,12H,1-3H3,(H,22,24)(H2,21,23,26)/t12-/m1/s1 |
| InChIKey | TVJSFLBDZBRDMQ-GFCCVEGCSA-N |
| XLogP | 4.40 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|