C17H25ClN4O4 — CID 34519988
[(2S)-1-[2-[(2S)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 34519988) has the molecular formula C17H25ClN4O4 and a molecular weight of 384.86 g/mol. Its IUPAC name is [(2S)-1-[2-[(2S)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | [(2S)-1-[2-[(2S)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 34519988 |
| Molecular Formula | C17H25ClN4O4 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(2S)-1-[2-[(2S)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | Cc1cc(Cl)cc(C)c1O[C@@H](C)C(=O)NNC(=O)[C@@H](NC(N)=O)C(C)C |
| InChI | InChI=1S/C17H25ClN4O4/c1-8(2)13(20-17(19)25)16(24)22-21-15(23)11(5)26-14-9(3)6-12(18)7-10(14)4/h6-8,11,13H,1-5H3,(H,21,23)(H,22,24)(H3,19,20,25)/t11-,13-/m0/s1 |
| InChIKey | SGGAMEAXNVPZIP-AAEUAGOBSA-N |
| XLogP | 1.56 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|