C20H24ClN3O5S — CID 41101544
4-[[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 41101544) has the molecular formula C20H24ClN3O5S and a molecular weight of 453.95 g/mol. Its IUPAC name is 4-[[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 41101544 |
| Molecular Formula | C20H24ClN3O5S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 4-[[[(2R)-2-(4-chloro-2,6-dimethylphenoxy)propanoyl]amino]carbamoyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)cc(C)c1O[C@H](C)C(=O)NNC(=O)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C20H24ClN3O5S/c1-12-10-16(21)11-13(2)18(12)29-14(3)19(25)22-23-20(26)15-6-8-17(9-7-15)30(27,28)24(4)5/h6-11,14H,1-5H3,(H,22,25)(H,23,26)/t14-/m1/s1 |
| InChIKey | WYXKJFSDBZAVTK-CQSZACIVSA-N |
| XLogP | 2.44 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|