C20H23ClN2O5S — CID 42910027
N'-[2-(4-chloro-2,6-dimethylphenoxy)propanoyl]-2-methyl-5-methylsulfonylbenzohydrazide (PubChem CID 42910027) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is N'-[2-(4-chloro-2,6-dimethylphenoxy)propanoyl]-2-methyl-5-methylsulfonylbenzohydrazide.
| Compound Name | N'-[2-(4-chloro-2,6-dimethylphenoxy)propanoyl]-2-methyl-5-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 42910027 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N'-[2-(4-chloro-2,6-dimethylphenoxy)propanoyl]-2-methyl-5-methylsulfonylbenzohydrazide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)NNC(=O)C(C)Oc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C20H23ClN2O5S/c1-11-6-7-16(29(5,26)27)10-17(11)20(25)23-22-19(24)14(4)28-18-12(2)8-15(21)9-13(18)3/h6-10,14H,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | GUBVZULBOGMFCL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|