C19H22N2O3 — CID 9297840
N'-[(2S)-2-(2,6-dimethylphenoxy)propanoyl]-2-methylbenzohydrazide (PubChem CID 9297840) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N'-[(2S)-2-(2,6-dimethylphenoxy)propanoyl]-2-methylbenzohydrazide.
| Compound Name | N'-[(2S)-2-(2,6-dimethylphenoxy)propanoyl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 9297840 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N'-[(2S)-2-(2,6-dimethylphenoxy)propanoyl]-2-methylbenzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)[C@H](C)Oc1c(C)cccc1C |
| InChI | InChI=1S/C19H22N2O3/c1-12-8-5-6-11-16(12)19(23)21-20-18(22)15(4)24-17-13(2)9-7-10-14(17)3/h5-11,15H,1-4H3,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | FLIUPBFJFDSKHB-HNNXBMFYSA-N |
| XLogP | 2.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|