C20H24N2O3 — CID 9297715
2-[[(2S)-2-(2,6-dimethylphenoxy)propanoyl]amino]-N-ethylbenzamide (PubChem CID 9297715) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[[(2S)-2-(2,6-dimethylphenoxy)propanoyl]amino]-N-ethylbenzamide.
| Compound Name | 2-[[(2S)-2-(2,6-dimethylphenoxy)propanoyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 9297715 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-[[(2S)-2-(2,6-dimethylphenoxy)propanoyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccccc1NC(=O)[C@H](C)Oc1c(C)cccc1C |
| InChI | InChI=1S/C20H24N2O3/c1-5-21-20(24)16-11-6-7-12-17(16)22-19(23)15(4)25-18-13(2)9-8-10-14(18)3/h6-12,15H,5H2,1-4H3,(H,21,24)(H,22,23)/t15-/m0/s1 |
| InChIKey | LFRRITNICAYVAB-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |