C25H32N2O3 — CID 4958547
N-cyclohexyl-2-[2-(2,6-dimethylphenoxy)propanoylamino]-N-methylbenzamide (PubChem CID 4958547) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-(2,6-dimethylphenoxy)propanoylamino]-N-methylbenzamide.
| Compound Name | N-cyclohexyl-2-[2-(2,6-dimethylphenoxy)propanoylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 4958547 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-cyclohexyl-2-[2-(2,6-dimethylphenoxy)propanoylamino]-N-methylbenzamide |
| SMILES | Cc1cccc(C)c1OC(C)C(=O)Nc1ccccc1C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C25H32N2O3/c1-17-11-10-12-18(2)23(17)30-19(3)24(28)26-22-16-9-8-15-21(22)25(29)27(4)20-13-6-5-7-14-20/h8-12,15-16,19-20H,5-7,13-14H2,1-4H3,(H,26,28) |
| InChIKey | VOKBBNRGVYQQDX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |