C17H16Cl2N2O4S2 — CID 24641183
N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-2-methyl-5-methylsulfonylbenzohydrazide (PubChem CID 24641183) has the molecular formula C17H16Cl2N2O4S2 and a molecular weight of 447.37 g/mol. Its IUPAC name is N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-2-methyl-5-methylsulfonylbenzohydrazide.
| Compound Name | N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-2-methyl-5-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 24641183 |
| Molecular Formula | C17H16Cl2N2O4S2 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-2-methyl-5-methylsulfonylbenzohydrazide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)NNC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O4S2/c1-10-3-5-12(27(2,24)25)8-13(10)17(23)21-20-16(22)9-26-15-7-11(18)4-6-14(15)19/h3-8H,9H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | OGATWNLPORJDRC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|