C16H13Cl3N2O2S2 — CID 24641126
2-chloro-N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-5-methylsulfanylbenzohydrazide (PubChem CID 24641126) has the molecular formula C16H13Cl3N2O2S2 and a molecular weight of 435.79 g/mol. Its IUPAC name is 2-chloro-N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-5-methylsulfanylbenzohydrazide.
| Compound Name | 2-chloro-N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-5-methylsulfanylbenzohydrazide |
|---|---|
| PubChem CID | 24641126 |
| Molecular Formula | C16H13Cl3N2O2S2 |
| Molecular Weight | 435.79 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | 2-chloro-N'-[2-(2,5-dichlorophenyl)sulfanylacetyl]-5-methylsulfanylbenzohydrazide |
| SMILES | CSc1ccc(Cl)c(C(=O)NNC(=O)CSc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H13Cl3N2O2S2/c1-24-10-3-5-12(18)11(7-10)16(23)21-20-15(22)8-25-14-6-9(17)2-4-13(14)19/h2-7H,8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | UEUFSLSJEAAVHR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.79 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|