C17H14Cl2FN3O3S — CID 24641164
N-[2-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-2-fluorobenzamide (PubChem CID 24641164) has the molecular formula C17H14Cl2FN3O3S and a molecular weight of 430.29 g/mol. Its IUPAC name is N-[2-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 24641164 |
| Molecular Formula | C17H14Cl2FN3O3S |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | N-[2-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]-2-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1ccccc1F)NNC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H14Cl2FN3O3S/c18-10-5-6-12(19)14(7-10)27-9-16(25)23-22-15(24)8-21-17(26)11-3-1-2-4-13(11)20/h1-7H,8-9H2,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | FKYLYQWTEHZDMR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|