C15H13Cl2N3O4S — CID 7969663
N-[2-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 7969663) has the molecular formula C15H13Cl2N3O4S and a molecular weight of 402.26 g/mol. Its IUPAC name is N-[2-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 7969663 |
| Molecular Formula | C15H13Cl2N3O4S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | N-[2-[2-[2-(2,5-dichlorophenyl)sulfanylacetyl]hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)NNC(=O)CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H13Cl2N3O4S/c16-9-3-4-10(17)12(6-9)25-8-14(22)20-19-13(21)7-18-15(23)11-2-1-5-24-11/h1-6H,7-8H2,(H,18,23)(H,19,21)(H,20,22) |
| InChIKey | IXMFZMSAHOMMGO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|