C15H13Cl2NO2S — CID 60627025
2-(2,5-dichlorophenyl)sulfanyl-N-phenylmethoxyacetamide (PubChem CID 60627025) has the molecular formula C15H13Cl2NO2S and a molecular weight of 342.25 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-N-phenylmethoxyacetamide.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 60627025 |
| Molecular Formula | C15H13Cl2NO2S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-N-phenylmethoxyacetamide |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)NOCc1ccccc1 |
| InChI | InChI=1S/C15H13Cl2NO2S/c16-12-6-7-13(17)14(8-12)21-10-15(19)18-20-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,18,19) |
| InChIKey | MOYGJAJEEQXHPR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|