C17H17Cl2N3OS2 — CID 2523245
3-benzyl-1-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]-1-methylthiourea (PubChem CID 2523245) has the molecular formula C17H17Cl2N3OS2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 3-benzyl-1-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]-1-methylthiourea.
| Compound Name | 3-benzyl-1-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]-1-methylthiourea |
|---|---|
| PubChem CID | 2523245 |
| Molecular Formula | C17H17Cl2N3OS2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 3-benzyl-1-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]-1-methylthiourea |
| SMILES | CN(NC(=O)CSc1cc(Cl)ccc1Cl)C(=S)NCc1ccccc1 |
| InChI | InChI=1S/C17H17Cl2N3OS2/c1-22(17(24)20-10-12-5-3-2-4-6-12)21-16(23)11-25-15-9-13(18)7-8-14(15)19/h2-9H,10-11H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | QZNGKTCONBBNKX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|