C15H15ClN2OS — CID 28973867
2-(2-amino-4-chlorophenyl)sulfanyl-N-benzylacetamide (PubChem CID 28973867) has the molecular formula C15H15ClN2OS and a molecular weight of 306.82 g/mol. Its IUPAC name is 2-(2-amino-4-chlorophenyl)sulfanyl-N-benzylacetamide.
| Compound Name | 2-(2-amino-4-chlorophenyl)sulfanyl-N-benzylacetamide |
|---|---|
| PubChem CID | 28973867 |
| Molecular Formula | C15H15ClN2OS |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(2-amino-4-chlorophenyl)sulfanyl-N-benzylacetamide |
| SMILES | Nc1cc(Cl)ccc1SCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H15ClN2OS/c16-12-6-7-14(13(17)8-12)20-10-15(19)18-9-11-4-2-1-3-5-11/h1-8H,9-10,17H2,(H,18,19) |
| InChIKey | FUQXDOJXFHXSPL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|