C18H21N3OS — CID 7979047
3-benzyl-1-[(3,4-dimethylbenzoyl)amino]-1-methylthiourea (PubChem CID 7979047) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 3-benzyl-1-[(3,4-dimethylbenzoyl)amino]-1-methylthiourea.
| Compound Name | 3-benzyl-1-[(3,4-dimethylbenzoyl)amino]-1-methylthiourea |
|---|---|
| PubChem CID | 7979047 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 3-benzyl-1-[(3,4-dimethylbenzoyl)amino]-1-methylthiourea |
| SMILES | Cc1ccc(C(=O)NN(C)C(=S)NCc2ccccc2)cc1C |
| InChI | InChI=1S/C18H21N3OS/c1-13-9-10-16(11-14(13)2)17(22)20-21(3)18(23)19-12-15-7-5-4-6-8-15/h4-11H,12H2,1-3H3,(H,19,23)(H,20,22) |
| InChIKey | NUVIEDNUUKAVNX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|