C24H25N2O2S+ — CID 8715297
(2S)-N-benzyl-3-(3,4-dimethylphenyl)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanethioamide (PubChem CID 8715297) has the molecular formula C24H25N2O2S+ and a molecular weight of 405.54 g/mol. Its IUPAC name is (2S)-N-benzyl-3-(3,4-dimethylphenyl)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanethioamide.
| Compound Name | (2S)-N-benzyl-3-(3,4-dimethylphenyl)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanethioamide |
|---|---|
| PubChem CID | 8715297 |
| Molecular Formula | C24H25N2O2S+ |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (2S)-N-benzyl-3-(3,4-dimethylphenyl)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanethioamide |
| SMILES | Cc1ccc(C(=O)[C@@H](C(=S)NCc2ccccc2)[n+]2cccc(CO)c2)cc1C |
| InChI | InChI=1S/C24H24N2O2S/c1-17-10-11-21(13-18(17)2)23(28)22(26-12-6-9-20(15-26)16-27)24(29)25-14-19-7-4-3-5-8-19/h3-13,15,22,27H,14,16H2,1-2H3/p+1/t22-/m0/s1 |
| InChIKey | WIOVLSVRJHWEMP-QFIPXVFZSA-O |
| XLogP | 3.62 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|