C15H16ClN2O2S2+ — CID 8653597
3-(5-chlorothiophen-2-yl)-N-ethyl-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanethioamide (PubChem CID 8653597) has the molecular formula C15H16ClN2O2S2+ and a molecular weight of 355.89 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-ethyl-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanethioamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-ethyl-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanethioamide |
|---|---|
| PubChem CID | 8653597 |
| Molecular Formula | C15H16ClN2O2S2+ |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-ethyl-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanethioamide |
| SMILES | CCNC(=S)C(C(=O)c1ccc(Cl)s1)[n+]1cccc(CO)c1 |
| InChI | InChI=1S/C15H15ClN2O2S2/c1-2-17-15(21)13(14(20)11-5-6-12(16)22-11)18-7-3-4-10(8-18)9-19/h3-8,13,19H,2,9H2,1H3/p+1 |
| InChIKey | QAKNREPFCCPLFL-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|