C18H19ClN2OS2 — CID 8653606
3-(5-chlorothiophen-2-yl)-N-ethyl-3-oxo-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanimidothioate (PubChem CID 8653606) has the molecular formula C18H19ClN2OS2 and a molecular weight of 378.95 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-ethyl-3-oxo-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanimidothioate.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-ethyl-3-oxo-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanimidothioate |
|---|---|
| PubChem CID | 8653606 |
| Molecular Formula | C18H19ClN2OS2 |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-ethyl-3-oxo-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)propanimidothioate |
| SMILES | CC/N=C(\[S-])C(C(=O)c1ccc(Cl)s1)[n+]1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H19ClN2OS2/c1-2-20-18(23)16(17(22)14-7-8-15(19)24-14)21-10-9-12-5-3-4-6-13(12)11-21/h7-11,16H,2-6H2,1H3 |
| InChIKey | ARSORYZDYYKQAS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 33.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|