C17H13ClN2O2S2 — CID 135761587
(2R)-3-(5-chlorothiophen-2-yl)-N-(furan-2-ylmethyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate (PubChem CID 135761587) has the molecular formula C17H13ClN2O2S2 and a molecular weight of 376.89 g/mol. Its IUPAC name is (2R)-3-(5-chlorothiophen-2-yl)-N-(furan-2-ylmethyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate.
| Compound Name | (2R)-3-(5-chlorothiophen-2-yl)-N-(furan-2-ylmethyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
|---|---|
| PubChem CID | 135761587 |
| Molecular Formula | C17H13ClN2O2S2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | (2R)-3-(5-chlorothiophen-2-yl)-N-(furan-2-ylmethyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
| SMILES | O=C(c1ccc(Cl)s1)[C@H](/C([S-])=N/Cc1ccco1)[n+]1ccccc1 |
| InChI | InChI=1S/C17H13ClN2O2S2/c18-14-7-6-13(24-14)16(21)15(20-8-2-1-3-9-20)17(23)19-11-12-5-4-10-22-12/h1-10,15H,11H2/t15-/m1/s1 |
| InChIKey | WCPLDYZBTJOABL-OAHLLOKOSA-N |
| XLogP | 3.85 |
| TPSA | 46.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|