C14H19ClIN3O2S — CID 111491493
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111491493) has the molecular formula C14H19ClIN3O2S and a molecular weight of 455.75 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111491493 |
| Molecular Formula | C14H19ClIN3O2S |
| Molecular Weight | 455.75 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C14H18ClN3O2S.HI/c1-2-16-14(17-8-10-4-3-7-20-10)18-9-11(19)12-5-6-13(15)21-12;/h3-7,11,19H,2,8-9H2,1H3,(H2,16,17,18);1H |
| InChIKey | QOMDFECUDCVJNZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|