C15H20ClN3OS2 — CID 111702011
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111702011) has the molecular formula C15H20ClN3OS2 and a molecular weight of 357.93 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111702011 |
| Molecular Formula | C15H20ClN3OS2 |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(5-methylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H20ClN3OS2/c1-3-17-15(18-8-11-5-4-10(2)21-11)19-9-12(20)13-6-7-14(16)22-13/h4-7,12,20H,3,8-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | OTXAJSMUELKAIS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|