C19H28ClIN4OS — CID 111702581
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111702581) has the molecular formula C19H28ClIN4OS and a molecular weight of 522.88 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111702581 |
| Molecular Formula | C19H28ClIN4OS |
| Molecular Weight | 522.88 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[4-[(dimethylamino)methyl]phenyl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN(C)C)cc1)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C19H27ClN4OS.HI/c1-4-21-19(23-12-16(25)17-9-10-18(20)26-17)22-11-14-5-7-15(8-6-14)13-24(2)3;/h5-10,16,25H,4,11-13H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | PPBCBWLYFTZAQJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|