C19H29ClIN5OS — CID 111702401
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[6-(diethylamino)-3-pyridinyl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111702401) has the molecular formula C19H29ClIN5OS and a molecular weight of 537.90 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[6-(diethylamino)-3-pyridinyl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[6-(diethylamino)-3-pyridinyl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111702401 |
| Molecular Formula | C19H29ClIN5OS |
| Molecular Weight | 537.90 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[[6-(diethylamino)-3-pyridinyl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N(CC)CC)nc1)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C19H28ClN5OS.HI/c1-4-21-19(24-13-15(26)16-8-9-17(20)27-16)23-12-14-7-10-18(22-11-14)25(5-2)6-3;/h7-11,15,26H,4-6,12-13H2,1-3H3,(H2,21,23,24);1H |
| InChIKey | MZQIUGPNRLHZSO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|