C17H23ClN4O3S2 — CID 111701903
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 111701903) has the molecular formula C17H23ClN4O3S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111701903 |
| Molecular Formula | C17H23ClN4O3S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)NC)cc1)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H23ClN4O3S2/c1-3-20-17(22-11-14(23)15-8-9-16(18)26-15)21-10-12-4-6-13(7-5-12)27(24,25)19-2/h4-9,14,19,23H,3,10-11H2,1-2H3,(H2,20,21,22) |
| InChIKey | SQUUBUZNSSCDPW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|