C22H32N4O4S — CID 109494061
1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 109494061) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109494061 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)NC)cc1)NCC(O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C22H32N4O4S/c1-5-24-22(25-14-17-6-12-20(13-7-17)31(28,29)23-4)26-15-21(27)18-8-10-19(11-9-18)30-16(2)3/h6-13,16,21,23,27H,5,14-15H2,1-4H3,(H2,24,25,26) |
| InChIKey | GQHIRPCKZSXXNN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|