C19H22ClN5OS — CID 111702616
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine (PubChem CID 111702616) has the molecular formula C19H22ClN5OS and a molecular weight of 403.94 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111702616 |
| Molecular Formula | C19H22ClN5OS |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(-c2ccccc2)[nH]1)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H22ClN5OS/c1-2-21-19(23-11-15(26)16-8-9-17(20)27-16)24-12-18-22-10-14(25-18)13-6-4-3-5-7-13/h3-10,15,26H,2,11-12H2,1H3,(H,22,25)(H2,21,23,24) |
| InChIKey | IPZZCEAODBIAOX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|