C20H29ClN4OS — CID 111702248
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[2-(dimethylamino)-3-phenylpropyl]-3-ethylguanidine (PubChem CID 111702248) has the molecular formula C20H29ClN4OS and a molecular weight of 409.00 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[2-(dimethylamino)-3-phenylpropyl]-3-ethylguanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[2-(dimethylamino)-3-phenylpropyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111702248 |
| Molecular Formula | C20H29ClN4OS |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[2-(dimethylamino)-3-phenylpropyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(Cc1ccccc1)N(C)C)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H29ClN4OS/c1-4-22-20(24-14-17(26)18-10-11-19(21)27-18)23-13-16(25(2)3)12-15-8-6-5-7-9-15/h5-11,16-17,26H,4,12-14H2,1-3H3,(H2,22,23,24) |
| InChIKey | MQFKZDXIPNMAAB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|