C20H29ClN4O2S — CID 111701873
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-ethylguanidine (PubChem CID 111701873) has the molecular formula C20H29ClN4O2S and a molecular weight of 425.00 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-ethylguanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111701873 |
| Molecular Formula | C20H29ClN4O2S |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-2-[2-(dimethylamino)-2-(3-methoxyphenyl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(c1cccc(OC)c1)N(C)C)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H29ClN4O2S/c1-5-22-20(24-13-17(26)18-9-10-19(21)28-18)23-12-16(25(2)3)14-7-6-8-15(11-14)27-4/h6-11,16-17,26H,5,12-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | SJKCGVUKXFRCRT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|