C15H27ClIN3OS — CID 111990094
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-(2-ethylbutyl)guanidine;hydroiodide (PubChem CID 111990094) has the molecular formula C15H27ClIN3OS and a molecular weight of 459.83 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-(2-ethylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-(2-ethylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111990094 |
| Molecular Formula | C15H27ClIN3OS |
| Molecular Weight | 459.83 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-(2-ethylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(CC)CC)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C15H26ClN3OS.HI/c1-4-11(5-2)9-18-15(17-6-3)19-10-12(20)13-7-8-14(16)21-13;/h7-8,11-12,20H,4-6,9-10H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | JWBDXCJTHALROU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|