C19H34ClN5OS — CID 111702254
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]guanidine (PubChem CID 111702254) has the molecular formula C19H34ClN5OS and a molecular weight of 416.04 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111702254 |
| Molecular Formula | C19H34ClN5OS |
| Molecular Weight | 416.04 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[3-methyl-2-(4-methylpiperazin-1-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CC(C(C)C)N1CCN(C)CC1)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H34ClN5OS/c1-5-21-19(23-13-16(26)17-6-7-18(20)27-17)22-12-15(14(2)3)25-10-8-24(4)9-11-25/h6-7,14-16,26H,5,8-13H2,1-4H3,(H2,21,22,23) |
| InChIKey | DVNVESMEBSGQFT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.04 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|