C14H17BrClN3OS2 — CID 111701895
2-[(5-bromothiophen-2-yl)methyl]-1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethylguanidine (PubChem CID 111701895) has the molecular formula C14H17BrClN3OS2 and a molecular weight of 422.80 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethylguanidine.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111701895 |
| Molecular Formula | C14H17BrClN3OS2 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(Br)s1)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H17BrClN3OS2/c1-2-17-14(18-7-9-3-5-12(15)21-9)19-8-10(20)11-4-6-13(16)22-11/h3-6,10,20H,2,7-8H2,1H3,(H2,17,18,19) |
| InChIKey | HZCQLJAKKLSRJD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|