C19H26ClN3O4S — CID 111702298
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine (PubChem CID 111702298) has the molecular formula C19H26ClN3O4S and a molecular weight of 427.95 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111702298 |
| Molecular Formula | C19H26ClN3O4S |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[(2,4,6-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1c(OC)cc(OC)cc1OC)NCC(O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H26ClN3O4S/c1-5-21-19(23-11-14(24)17-6-7-18(20)28-17)22-10-13-15(26-3)8-12(25-2)9-16(13)27-4/h6-9,14,24H,5,10-11H2,1-4H3,(H2,21,22,23) |
| InChIKey | MQMRLCYQSOETCO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|