C19H24ClIN6O2S — CID 111701844
1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide (PubChem CID 111701844) has the molecular formula C19H24ClIN6O2S and a molecular weight of 562.87 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111701844 |
| Molecular Formula | C19H24ClIN6O2S |
| Molecular Weight | 562.87 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-2-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccc(OC)cc2)n[nH]1)NCC(O)c1ccc(Cl)s1.I |
| InChI | InChI=1S/C19H23ClN6O2S.HI/c1-3-21-19(22-10-14(27)15-8-9-16(20)29-15)23-11-17-24-18(26-25-17)12-4-6-13(28-2)7-5-12;/h4-9,14,27H,3,10-11H2,1-2H3,(H2,21,22,23)(H,24,25,26);1H |
| InChIKey | ZFLCINMSQMFJAB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|