C20H23ClN6O — CID 111175335
2-[(2-chlorophenyl)methyl]-1-ethyl-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine (PubChem CID 111175335) has the molecular formula C20H23ClN6O and a molecular weight of 398.90 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111175335 |
| Molecular Formula | C20H23ClN6O |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCc1nc(-c2ccc(OC)cc2)n[nH]1 |
| InChI | InChI=1S/C20H23ClN6O/c1-3-22-20(23-12-15-6-4-5-7-17(15)21)24-13-18-25-19(27-26-18)14-8-10-16(28-2)11-9-14/h4-11H,3,12-13H2,1-2H3,(H2,22,23,24)(H,25,26,27) |
| InChIKey | JQVUOXXQFFNPOM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|