C20H25IN6O — CID 111360522
1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[(2-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111360522) has the molecular formula C20H25IN6O and a molecular weight of 492.37 g/mol. Its IUPAC name is 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[(2-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[(2-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111360522 |
| Molecular Formula | C20H25IN6O |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[(2-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(-c2ccc(OC)cc2)n[nH]1)NCc1ccccc1C.I |
| InChI | InChI=1S/C20H24N6O.HI/c1-14-6-4-5-7-16(14)12-22-20(21-2)23-13-18-24-19(26-25-18)15-8-10-17(27-3)11-9-15;/h4-11H,12-13H2,1-3H3,(H2,21,22,23)(H,24,25,26);1H |
| InChIKey | KHILLHOPWDQCOB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|