C20H25IN6O2 — CID 111006368
1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111006368) has the molecular formula C20H25IN6O2 and a molecular weight of 508.36 g/mol. Its IUPAC name is 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111006368 |
| Molecular Formula | C20H25IN6O2 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1ccccc1)NCc1nc(-c2ccc(OC)cc2)n[nH]1.I |
| InChI | InChI=1S/C20H24N6O2.HI/c1-21-20(22-12-13-28-17-6-4-3-5-7-17)23-14-18-24-19(26-25-18)15-8-10-16(27-2)11-9-15;/h3-11H,12-14H2,1-2H3,(H2,21,22,23)(H,24,25,26);1H |
| InChIKey | RSHSFZAPKPNPNP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|