C19H28N6O2 — CID 111392711
1-[3-(cyclopropylmethoxy)propyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine (PubChem CID 111392711) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111392711 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCOCC1CC1)NCc1nc(-c2ccc(OC)cc2)n[nH]1 |
| InChI | InChI=1S/C19H28N6O2/c1-20-19(21-10-3-11-27-13-14-4-5-14)22-12-17-23-18(25-24-17)15-6-8-16(26-2)9-7-15/h6-9,14H,3-5,10-13H2,1-2H3,(H2,20,21,22)(H,23,24,25) |
| InChIKey | VDUNPKASXVBJMA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|