C19H29IN6O — CID 111256942
1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide (PubChem CID 111256942) has the molecular formula C19H29IN6O and a molecular weight of 484.39 g/mol. Its IUPAC name is 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111256942 |
| Molecular Formula | C19H29IN6O |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(4-methylcyclohexyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(-c2ccc(OC)cc2)n[nH]1)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C19H28N6O.HI/c1-13-4-8-15(9-5-13)22-19(20-2)21-12-17-23-18(25-24-17)14-6-10-16(26-3)11-7-14;/h6-7,10-11,13,15H,4-5,8-9,12H2,1-3H3,(H2,20,21,22)(H,23,24,25);1H |
| InChIKey | CARWIZDJAAGBJY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|