C19H21F2IN6O — CID 111902372
1-[(2,5-difluorophenyl)methyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111902372) has the molecular formula C19H21F2IN6O and a molecular weight of 514.32 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111902372 |
| Molecular Formula | C19H21F2IN6O |
| Molecular Weight | 514.32 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(-c2ccc(OC)cc2)n[nH]1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C19H20F2N6O.HI/c1-22-19(23-10-13-9-14(20)5-8-16(13)21)24-11-17-25-18(27-26-17)12-3-6-15(28-2)7-4-12;/h3-9H,10-11H2,1-2H3,(H2,22,23,24)(H,25,26,27);1H |
| InChIKey | RMMGHYWEDPKZHR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|