C20H21F3N6O2 — CID 111848005
1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111848005) has the molecular formula C20H21F3N6O2 and a molecular weight of 434.42 g/mol. Its IUPAC name is 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111848005 |
| Molecular Formula | C20H21F3N6O2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1nc(-c2ccc(OC)cc2)n[nH]1)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H21F3N6O2/c1-24-19(25-11-14-5-3-4-6-16(14)31-20(21,22)23)26-12-17-27-18(29-28-17)13-7-9-15(30-2)10-8-13/h3-10H,11-12H2,1-2H3,(H2,24,25,26)(H,27,28,29) |
| InChIKey | FQPXBXWASZBYGF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|