C17H27IN6O2 — CID 111606016
1-(2-methoxy-2-methylpropyl)-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111606016) has the molecular formula C17H27IN6O2 and a molecular weight of 474.35 g/mol. Its IUPAC name is 1-(2-methoxy-2-methylpropyl)-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-methoxy-2-methylpropyl)-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111606016 |
| Molecular Formula | C17H27IN6O2 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 1-(2-methoxy-2-methylpropyl)-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(-c2ccc(OC)cc2)n[nH]1)NCC(C)(C)OC.I |
| InChI | InChI=1S/C17H26N6O2.HI/c1-17(2,25-5)11-20-16(18-3)19-10-14-21-15(23-22-14)12-6-8-13(24-4)9-7-12;/h6-9H,10-11H2,1-5H3,(H2,18,19,20)(H,21,22,23);1H |
| InChIKey | BFDUYHBFIKDTQV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|