C22H29IN6O3 — CID 111215008
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111215008) has the molecular formula C22H29IN6O3 and a molecular weight of 552.42 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111215008 |
| Molecular Formula | C22H29IN6O3 |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC)c1)NCc1nc(-c2ccc(OC)cc2)n[nH]1.I |
| InChI | InChI=1S/C22H28N6O3.HI/c1-23-22(24-12-11-15-5-10-18(30-3)19(13-15)31-4)25-14-20-26-21(28-27-20)16-6-8-17(29-2)9-7-16;/h5-10,13H,11-12,14H2,1-4H3,(H2,23,24,25)(H,26,27,28);1H |
| InChIKey | KCEBQKGFEQCIBO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|