C16H25IN6O — CID 110945727
1-butan-2-yl-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 110945727) has the molecular formula C16H25IN6O and a molecular weight of 444.32 g/mol. Its IUPAC name is 1-butan-2-yl-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110945727 |
| Molecular Formula | C16H25IN6O |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 1-butan-2-yl-3-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCC(C)N/C(=N\C)NCc1nc(-c2ccc(OC)cc2)n[nH]1.I |
| InChI | InChI=1S/C16H24N6O.HI/c1-5-11(2)19-16(17-3)18-10-14-20-15(22-21-14)12-6-8-13(23-4)9-7-12;/h6-9,11H,5,10H2,1-4H3,(H2,17,18,19)(H,20,21,22);1H |
| InChIKey | AKZZEFPPEBVJQP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|