C22H27IN6O — CID 111856685
1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 111856685) has the molecular formula C22H27IN6O and a molecular weight of 518.40 g/mol. Its IUPAC name is 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111856685 |
| Molecular Formula | C22H27IN6O |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(-c2ccc(OC)cc2)n[nH]1)NCC1(c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H26N6O.HI/c1-23-21(25-15-22(12-13-22)17-6-4-3-5-7-17)24-14-19-26-20(28-27-19)16-8-10-18(29-2)11-9-16;/h3-11H,12-15H2,1-2H3,(H2,23,24,25)(H,26,27,28);1H |
| InChIKey | GPELJGXTXWZBOA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|