C18H25IN8O — CID 111904996
1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111904996) has the molecular formula C18H25IN8O and a molecular weight of 496.36 g/mol. Its IUPAC name is 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111904996 |
| Molecular Formula | C18H25IN8O |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 1-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cccn1)NCc1nc(-c2ccc(OC)cc2)n[nH]1.I |
| InChI | InChI=1S/C18H24N8O.HI/c1-19-18(20-9-3-11-26-12-4-10-22-26)21-13-16-23-17(25-24-16)14-5-7-15(27-2)8-6-14;/h4-8,10,12H,3,9,11,13H2,1-2H3,(H2,19,20,21)(H,23,24,25);1H |
| InChIKey | MDUOKBVPMKOUQU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|