C17H20ClIN6O — CID 111835488
2-[(2-chlorophenyl)methyl]-1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide (PubChem CID 111835488) has the molecular formula C17H20ClIN6O and a molecular weight of 486.75 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111835488 |
| Molecular Formula | C17H20ClIN6O |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCc1nc(-c2ccco2)n[nH]1.I |
| InChI | InChI=1S/C17H19ClN6O.HI/c1-2-19-17(20-10-12-6-3-4-7-13(12)18)21-11-15-22-16(24-23-15)14-8-5-9-25-14;/h3-9H,2,10-11H2,1H3,(H2,19,20,21)(H,22,23,24);1H |
| InChIKey | RFTOLXZZACYULC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|