C18H23IN6O2 — CID 111834184
1-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111834184) has the molecular formula C18H23IN6O2 and a molecular weight of 482.33 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111834184 |
| Molecular Formula | C18H23IN6O2 |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 1-ethyl-2-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-3-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccco2)n[nH]1)NCCOc1ccccc1.I |
| InChI | InChI=1S/C18H22N6O2.HI/c1-2-19-18(20-10-12-25-14-7-4-3-5-8-14)21-13-16-22-17(24-23-16)15-9-6-11-26-15;/h3-9,11H,2,10,12-13H2,1H3,(H2,19,20,21)(H,22,23,24);1H |
| InChIKey | JJBYUNBYVIVNPW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|